Oxymatrine (Standard) | CAS | 16837-52-8 |
| Molecular Weight | 264.36 |
| Formula | C15H24N2O2 |
| SMILES | O=C1CCC[C@]2([H])[C@@]3([H])CCC[N@@+]4([O-])[C@@]3([H])[C@](CCC4)([H])CN21 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16849 | Eucommiol | Inquiry |
|
| PDP-15305 | Anonaine | Inquiry |
|
| PDP-16629 | 2,6,10,14-Tetramethylhexadecane | Inquiry |
|
| PDP-16208 | N-Formylcytisine | Inquiry |
|
| PDP-15349 | Vanicoside B | Inquiry |
|
| PDP-15502 | Hecogenin Acetate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
