Phosphorylcholine | CAS No. | 3616-04-4 |
| Purity | ≥98.0% |
| Synonyms | Phosphocholine |
| Molecular Weight | 183.14 |
| Formula | C5H14NO4P |
| Appearance | Oil |
| Color | Colorless to light yellow |
| SMILES | O=P(OCC[N+](C)(C)C)([O-])O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (stored under nitrogen) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11767 | 2-Acetylfuran | Inquiry |
|
| MDP-11869 | α-Carotene | Inquiry |
|
| MDP-23830 | Avidinorubicin | Inquiry |
|
| MDP-22524 | Arborcandin F | Inquiry |
|
| MDP-22601 | Gliocladic Acid | Inquiry |
|
| MDP-12660 | Herpotrichone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
