Physalin D | CAS | 54980-22-2 |
| Molecular Weight | 544.55 |
| Formula | C28H32O11 |
| SMILES | C[C@]12[C@]34[C@]5([H])[C@]6([C@@](C(O[C@@H]2C6)=O)([H])CO[C@](C5=O)([C@@]7([H])[C@]([C@@]8([C@@]([C@@H](C7)O)(CC=CC8=O)O)C)([H])CC[C@@]4(C(O1)=O)O)O3)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15698 | Alpha-Solamarine | Inquiry |
|
| PDP-14209 | 9"-Methyl Salvianolate B | Inquiry |
|
| PDP-16330 | Euonymine | Inquiry |
|
| PDP-19488 | Ro 09-0680 | Inquiry |
|
| PDP-13812 | β-Bisabolene | Inquiry |
|
| PDP-15614 | Macranthoside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
