Physalin H | CAS | 70241-09-7 |
| Molecular Weight | 562.99 |
| Formula | C28H31ClO10 |
| SMILES | C[C@@]([C@H](OC1=O)C2)(OC3=O)[C@](O[C@@]45C6=O)([C@]3(CC[C@@]([C@]([C@@]7(CC=C8)Cl)(C8=O)C)([H])[C@@]4([H])C[C@H]7O)O)[C@@]6([H])[C@]2([C@@]1([H])CO5)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15459 | 6"-O-Acetyldaidzin | Inquiry |
|
| PDP-17457 | (20S)-Protopanaxadiol-3-one | Inquiry |
|
| PDP-13727 | S-1-Propenyl-L-cysteine | Inquiry |
|
| PDP-16636 | Folinic Acid (Standard) | Inquiry |
|
| PDP-20542 | Jujuboside B (Standard) | Inquiry |
|
| PDP-13219 | Brassinolide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
