Physcion | Synonyms | Parietin; Rheochrysidin |
| Appearance | Solid |
| CAS | 521-61-9 |
| Purity | 99.10% |
| Molecular Weight | 284.26 |
| Formula | C16H12O5 |
| Color | Yellow to orange |
| SMILES | O=C1C2=C(C=C(C)C=C2O)C(C3=CC(OC)=CC(O)=C13)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16394 | Rebaudioside I | Inquiry |
|
| PDP-18475 | Clematomandshurica Saponin B | Inquiry |
|
| PDP-17822 | Ciwujianoside D1 | Inquiry |
|
| PDP-14941 | 8-Deoxygartanin | Inquiry |
|
| PDP-15104 | γ-Hexalactone | Inquiry |
|
| PDP-20298 | Angeloylgomisin Q | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
