Procyanidin B2 (Standard) | Synonyms | Proanthocyanidin B2 (Standard) |
| Appearance | Solid |
| CAS | 29106-49-8 |
| Molecular Weight | 578.52 |
| Formula | C₃₀H₂₆O₁₂ |
| Color | Light yellow to light brown |
| SMILES | O[C@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C3[C@@H]1C4=C5C(C[C@@H](O)[C@@H](C6=CC=C(O)C(O)=C6)O5)=C(O)C=C4O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16875 | Esculentoside B | Inquiry |
|
| PDP-18957 | Uzarin | Inquiry |
|
| PDP-17332 | Toddanone | Inquiry |
|
| PDP-13153 | Picropodophyllin | Inquiry |
|
| PDP-18487 | Pseudoprotogracillin | Inquiry |
|
| PDP-13144 | L-Ascorbic Acid Sodium Salt | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
