Prosaikogenin D | Appearance | Solid |
| CAS | 103629-72-7 |
| Purity | 99.09% |
| Molecular Weight | 618.84 |
| Formula | C36H58O8 |
| Color | White to off-white |
| SMILES | O[C@H]([C@H]([C@H]([C@@H](C)O1)O)O)[C@@H]1O[C@@H]2CC[C@]3(C)[C@@]4([H])C=CC5=C6CC(C)(C)CC[C@@](CO)6[C@@H](O)C[C@](C)5[C@@](C)4CC[C@]([H])3[C@@]2(C)CO |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16615 | 1-(3-Nitrophenyl)ethanone | Inquiry |
|
| PDP-18375 | Fargesone B | Inquiry |
|
| PDP-20157 | Pseudohypericin (Standard) | Inquiry |
|
| PDP-19436 | Pterodontic Acid | Inquiry |
|
| PDP-15833 | Chrysoobtusin | Inquiry |
|
| PDP-16856 | BChE-IN-11 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
