Pulchinenoside B | CAS | 135247-95-9 |
| Molecular Weight | 1075.24 |
| Formula | C53H86O22 |
| SMILES | OC[C@H]([C@@H](O[C@@]1([H])[C@@H]([C@@H]([C@@H](O)[C@H](C)O1)O)O)[C@H](O)[C@H]2O)O[C@H]2OC[C@H]([C@@H](O)[C@H](O)[C@H]3O)O[C@H]3OC([C@]45[C@@]([C@H](C(C)=C)CC5)([H])[C@]6([H])[C@](C)([C@]7([C@]([C@@]8([C@@]([C@@](C)([C@@H](O[C@@]9([H])[C@@H]([C@H]([C@@H](O)CO9)O)O)CC8)CO)([H])CC7)C)([H])CC6)C)CC4)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17121 | (-)-Praeruptorin A | Inquiry |
|
| PDP-18764 | Echinatine N-oxide | Inquiry |
|
| PDP-14970 | Chrysanthemol | Inquiry |
|
| PDP-14566 | Licoflavonol | Inquiry |
|
| PDP-20198 | Delphinidin-3-O-galactoside (chloride) (Standard) | Inquiry |
|
| PDP-19591 | 10-Hydroxycanthin-6-one | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
