Echinatine N-oxide | CAS | 20267-93-0 |
| Molecular Weight | 315.36 |
| Formula | C15H25NO6 |
| SMILES | CC(C)[C@@]([C@@H](O)C)(O)C(OCC1=CC[N+]2([O-])[C@@]1([H])[C@H](CC2)O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14748 | Desmethylglycitein | Inquiry |
|
| PDP-18125 | Odorine | Inquiry |
|
| PDP-19232 | Borapetoside F | Inquiry |
|
| PDP-17935 | 1-Deacetylnimbolinin B | Inquiry |
|
| PDP-14114 | Artemotil | Inquiry |
|
| PDP-13353 | Poliumoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
