Pyracrenic Acid | CAS | 80832-44-6 |
| Molecular Weight | 618.84 |
| Formula | C39H54O6 |
| SMILES | CC1(C)[C@@H](OC(/C=C/C2=CC=C(O)C(O)=C2)=O)CC[C@]3(C)[C@@]4([H])CC[C@]5([H])[C@@]6([H])[C@H](C(C)=C)CC[C@@](C(O)=O)6CC[C@](C)5[C@@](C)4CC[C@@]13[H] |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19481 | Ailancoumarin E | Inquiry |
|
| PDP-17634 | (+)-Oxypeucedanin Methanolate | Inquiry |
|
| PDP-14035 | 3'-Hydroxypterostilbene | Inquiry |
|
| PDP-19700 | Hydrocotoin | Inquiry |
|
| PDP-19439 | Pyrroside B | Inquiry |
|
| PDP-16482 | Batatasin III | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
