Quercetin 3-O-(6"-galloyl)-β-D-galactopyranoside | Appearance | Solid |
| CAS | 53171-28-1 |
| Purity | 99.83% |
| Molecular Weight | 616.48 |
| Formula | C28H24O16 |
| Color | Light yellow to yellow |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@H]([C@@H](COC(C3=CC(O)=C(O)C(O)=C3)=O)O2)O)O)O)=C(C4=CC=C(O)C(O)=C4)OC5=CC(O)=CC(O)=C15 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16978 | Epiyangambin | Inquiry |
|
| PDP-17801 | Triptonoterpenol | Inquiry |
|
| PDP-19280 | Schiarisanrin B | Inquiry |
|
| PDP-20364 | Floramultine | Inquiry |
|
| PDP-19454 | N-(3-Phenylpropanoyl)pyrrole | Inquiry |
|
| PDP-14100 | Medicarpin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
