Quercimeritrin | Synonyms | Quercetin-7-O-β-D-glucopyranoside |
| Appearance | Solid |
| CAS | 491-50-9 |
| Purity | 99.51% |
| Molecular Weight | 464.38 |
| Formula | C21H20O12 |
| Color | White to yellow |
| SMILES | OC1=CC=C(C(OC2=C3C(O)=CC(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=C2)=C(O)C3=O)C=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18965 | Antiproliferative Agent-28 | Inquiry |
|
| PDP-15444 | Isosilybin B | Inquiry |
|
| PDP-15057 | Quercetin 3-O-neohesperidoside | Inquiry |
|
| PDP-17713 | Changnanic Acid | Inquiry |
|
| PDP-20490 | Licochalcone B (Standard) | Inquiry |
|
| PDP-14039 | Monotropein | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
