Renchangianin B | CAS | 770733-54-5 |
| Molecular Weight | 622.66 |
| Formula | C34H38O11 |
| SMILES | C/C=C(C)\C(O[C@@H]1[C@H](C)[C@](C)(O)[C@@H](OC(C2=CC=CC=C2)=O)C3=CC(OC)=C(OC)C(O)=C3C4=C1C=C(OC)C(OC)=C4O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17398 | 2-Hydroxy4,7-dimethoxy-9,10-dihydrophenanthrene | Inquiry |
|
| PDP-16203 | Epimedoside | Inquiry |
|
| PDP-13763 | Cinchonine | Inquiry |
|
| PDP-16787 | Costunolide (Standard) | Inquiry |
|
| PDP-14188 | Kukoamine A | Inquiry |
|
| PDP-15840 | α-Chaconine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
