Resiniferatoxin | Synonyms | (+)-Resiniferatoxin |
| Appearance | Solid |
| CAS | 57444-62-9 |
| Purity | 99.77% |
| Molecular Weight | 628.71 |
| Formula | C37H40O9 |
| SMILES | C[C@H]1[C@]23[C@](C=C(C[C@]4([C@@]3([H])C=C(C4=O)C)O)COC(CC5=CC(OC)=C(C=C5)O)=O)([H])[C@]6([H])[C@](C1)(O[C@](O2)(O6)CC7=CC=CC=C7)C(C)=C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17157 | Edgeworoside C | Inquiry |
|
| PDP-13901 | Nonivamide | Inquiry |
|
| PDP-15660 | Rubinaphthin A | Inquiry |
|
| PDP-13788 | Tetrahydroberberine | Inquiry |
|
| PDP-17500 | Nemerosin | Inquiry |
|
| PDP-16330 | Euonymine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
