Rhein 8-Glucoside | Synonyms | Rhein 8-O-β-D-Glucopyranoside |
| Appearance | Solid |
| CAS | 34298-86-7 |
| Purity | 99.81% |
| Molecular Weight | 446.36 |
| Formula | C21H18O11 |
| Color | Light yellow to yellow |
| SMILES | O=C(C1=CC(C(O)=O)=CC(O)=C1C2=O)C3=C2C(O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO)=CC=C3 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15887 | Absinthin | Inquiry |
|
| PDP-16198 | β-Hederin | Inquiry |
|
| PDP-15704 | Lirioprolioside B | Inquiry |
|
| PDP-14821 | Dactylorhin A | Inquiry |
|
| PDP-20427 | Gambogic Acid (Standard) | Inquiry |
|
| PDP-18701 | Sempervirine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
