Lirioprolioside B | Appearance | Solid |
| CAS | 182284-68-0 |
| Purity | ≥98.0% |
| Molecular Weight | 764.94 |
| Formula | C41H64O13 |
| Color | White to off-white |
| SMILES | O[C@@H]([C@H]([C@@H](C)O1)O)[C@@H](O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)OC(C)=O)O)[C@@H]1O[C@@H]3C[C@H](O)CC4=CC[C@@]5([H])[C@]6([H])C[C@@]7(O[C@@]8(OC[C@@H](C)CC8)[C@@H](C)[C@@]7([C@]6(CC[C@]5([H])[C@@]34C)C)[H])[H] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20412 | Verbascoside (Standard) | Inquiry |
|
| PDP-14053 | Neomangiferin | Inquiry |
|
| PDP-14571 | Cannflavin B | Inquiry |
|
| PDP-18306 | Cycloshizukaol A | Inquiry |
|
| PDP-20503 | 10-Methoxycamptothecin (Standard) | Inquiry |
|
| PDP-16087 | Caulilexin C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
