Rhein (Standard) | Synonyms | Rheic Acid (Standard); Rhubarb Yellow (Standard); Monorhein (Standard) |
| CAS | 478-43-3 |
| Molecular Weight | 284.22 |
| Formula | C₁₅H₈O₆ |
| SMILES | O=C(C(C=C1C2=O)=CC(O)=C1C(C3=C2C=CC=C3O)=O)O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19778 | Calceolarioside B (Standard) | Inquiry |
|
| PDP-16172 | Mogroside II-A | Inquiry |
|
| PDP-17016 | Chamaejasmenin C | Inquiry |
|
| PDP-14072 | Isorhamnetin-3-O-glucoside | Inquiry |
|
| PDP-19600 | Heishuixiecaoline A | Inquiry |
|
| PDP-16993 | (-)-Integerrimine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
