Sartorypyrone B | CAS No. | 1452396-11-0 |
| Molecular Weight | 514.65 |
| Formula | C30H42O7 |
| SMILES | C[C@@]([C@]1([H])C(C)([C@H]2OC(C)=O)C)(C[C@@H]2OC(C)=O)[C@](CC[C@@]34C)([H])[C@]([C@]3([H])CC(C5=O)=C(OC(C)=C5)O4)(CC1)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23935 | Mniopetal B | Inquiry |
|
| MDP-23785 | Chrysospermin B | Inquiry |
|
| MDP-11232 | SAICAR | Inquiry |
|
| MDP-23380 | Ivermectin (Standard) | Inquiry |
|
| MDP-24245 | Galacardin A | Inquiry |
|
| MDP-22131 | Kapurimycin A2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
