Scholaricine | CAS | 99694-90-3 |
| Molecular Weight | 356.42 |
| Formula | C20H24N2O4 |
| SMILES | COC(C1=C2[C@]3(C4=CC=CC(O)=C4N2)[C@@]5([H])N(C[C@]([C@]1([H])C5)([H])[C@@H](O)C)CC3)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15048 | Xanthopurpurin | Inquiry |
|
| PDP-18461 | Dihydrocucurbitacin B | Inquiry |
|
| PDP-13687 | Ganoderic Acid D | Inquiry |
|
| PDP-13221 | Diosmetin | Inquiry |
|
| PDP-15289 | Sarracenin | Inquiry |
|
| PDP-16969 | Anagyrine Hydrochloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
