Semialactone | CAS | 366450-46-6 |
| Molecular Weight | 468.67 |
| Formula | C30H44O4 |
| SMILES | C[C@]12[C@@](CC[C@@]3([H])[C@]2(CC[C@@H]3C([C@H]4OC(C(C)=CC4)=O)=C)C)([H])[C@]56[C@](CC1)([H])C(C)([C@](CC5)(OC6)O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17258 | Nardoguaianone K | Inquiry |
|
| PDP-18703 | Eulophiol | Inquiry |
|
| PDP-16339 | Chamigrenal | Inquiry |
|
| PDP-18820 | Raddeanoside R17 | Inquiry |
|
| PDP-19358 | 2α,3α,24-Trihydroxyolean-12-en-28-oic Acid | Inquiry |
|
| PDP-13819 | Eupalinolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
