Sennidin B | Appearance | Solid |
| CAS | 517-44-2 |
| Purity | 99.25% |
| Molecular Weight | 538.46 |
| Formula | C30H18O10 |
| Color | Yellow to brown |
| SMILES | O=C1C2=C(O)C=C(C(O)=O)C=C2[C@@]([C@]3([H])C4=CC(C(O)=O)=CC(O)=C4C(C5=C(O)C=CC=C35)=O)([H])C6=CC=CC(O)=C16 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light The compound is unstable in solutions, freshly prepared is recommended. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19264 | Kokusaginine | Inquiry |
|
| PDP-18254 | Isochamaejasmin | Inquiry |
|
| PDP-17574 | Selaginellin I | Inquiry |
|
| PDP-15139 | Visnagin | Inquiry |
|
| PDP-15632 | Lucideric Acid A | Inquiry |
|
| PDP-17981 | Ligupurpuroside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
