Sericoside | Appearance | Solid |
| CAS | 55306-04-2 |
| Purity | 98.86% |
| Molecular Weight | 666.84 |
| Formula | C36H58O11 |
| Color | Off-white to light yellow |
| SMILES | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC([C@]23[C@]([C@@H](C(C)(CC3)C)O)([H])C4=CC[C@@]([C@@]5([C@@]([C@](C)([C@H]([C@@H](C5)O)O)CO)([H])CC6)C)([H])[C@]6(C)[C@@]4(CC2)C)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17873 | Myrrhterpenoid O | Inquiry |
|
| PDP-13295 | Toosendanin | Inquiry |
|
| PDP-16144 | 2-Hydroxy-1-methoxyanthraquinone | Inquiry |
|
| PDP-15788 | Gitoxin | Inquiry |
|
| PDP-18054 | 9-Oxonerolidol | Inquiry |
|
| PDP-14301 | Armepavine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
