Sinapine Hydroxide | CAS | 122-30-5 |
| Molecular Weight | 327.37 |
| Formula | C16H25NO6 |
| SMILES | O=C(OCC[N+](C)(C)C)/C=C/C(C=C1OC)=CC(OC)=C1O.[OH-] |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17993 | p-Hydroxyphenethyl Anisate | Inquiry |
|
| PDP-14260 | Gnetol | Inquiry |
|
| PDP-13517 | Castanospermine | Inquiry |
|
| PDP-18004 | Guvacine | Inquiry |
|
| PDP-17105 | Ancistrotecine B | Inquiry |
|
| PDP-16208 | N-Formylcytisine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
