p-Hydroxyphenethyl Anisate | Synonyms | 4-Hydroxyphenethyl Anisate |
| CAS | 87932-34-1 |
| Molecular Weight | 272.30 |
| Formula | C16H16O4 |
| SMILES | O=C(OCCC1=CC=C(O)C=C1)C2=CC=C(OC)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14615 | Parishin E | Inquiry |
|
| PDP-15950 | 5,7-Dimethoxyluteolin | Inquiry |
|
| PDP-14779 | Pedunculoside | Inquiry |
|
| PDP-19285 | Volvalerenal E | Inquiry |
|
| PDP-17044 | Methylenetanshinquinone | Inquiry |
|
| PDP-18688 | Securitinine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
