Sonnerphenolic B | CAS | 1627516-10-2 |
| Molecular Weight | 282.33 |
| Formula | C18H18O3 |
| SMILES | OC(C=C1/C=C\[C@H](C2=CC=C(C=C2)O)C=C)=C(C=C1)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17711 | Anticancer Agent 149 | Inquiry |
|
| PDP-13597 | Mollugin | Inquiry |
|
| PDP-17824 | Majoranaquinone | Inquiry |
|
| PDP-19339 | Matairesinol 4'-O-β-D-glucopyranoside | Inquiry |
|
| PDP-20254 | Swertianine | Inquiry |
|
| PDP-19329 | Quinidine Sulfate Dihydrate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
