Swertianine | CAS | 20882-75-1 |
| Molecular Weight | 274.23 |
| Formula | C14H10O6 |
| SMILES | O=C1C2=C(OC3=C1C(O)=CC(OC)=C3)C=CC(O)=C2O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16800 | Methyl-Hesperidin (Standard) | Inquiry |
|
| PDP-13819 | Eupalinolide B | Inquiry |
|
| PDP-19776 | Pentagalloylglucose (Standard) | Inquiry |
|
| PDP-16631 | trans-β-Ocimene | Inquiry |
|
| PDP-14792 | 4-Vinylsyringol | Inquiry |
|
| PDP-17640 | Thevebioside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
