Spinosin (Standard) | CAS | 72063-39-9 |
| Molecular Weight | 608.54 |
| Formula | C28H32O15 |
| SMILES | COC1=C([C@H](O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]2O[C@]([C@@H]([C@@H](O)[C@@H]3O)O)([H])O[C@@H]3CO)C(O)=C4C(OC(C5=CC=C(O)C=C5)=CC4=O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17073 | Hispidanin B | Inquiry |
|
| PDP-15557 | Taccalonolide A | Inquiry |
|
| PDP-17915 | Santamarine | Inquiry |
|
| PDP-14772 | Peonidin 3-O-glucoside Chloride | Inquiry |
|
| PDP-19222 | (-)-Coclaurine Hydrochloride | Inquiry |
|
| PDP-13554 | Isoimperatorin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
