Syringetin-3-O-glucoside | Synonyms | Syringetin 3-O-β-D-glucoside |
| Appearance | Solid |
| CAS | 40039-49-4 |
| Molecular Weight | 508.43 |
| Formula | C23H24O13 |
| Color | Light yellow to yellow |
| SMILES | O=C(C(O[C@@H]1O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO)=C(C2=CC(OC)=C(C(OC)=C2)O)OC3=CC(O)=C4)C3=C4O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19425 | 1β-Hydroxy-4(15),5E,10(14)-germacratriene | Inquiry |
|
| PDP-14793 | Silydianin | Inquiry |
|
| PDP-18993 | Kuwanon B | Inquiry |
|
| PDP-15172 | Rosamultin | Inquiry |
|
| PDP-20432 | Cyclovirobuxine D (Standard) | Inquiry |
|
| PDP-14591 | Curzerenone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
