Tetrahydromagnolol | Synonyms | Magnolignan |
| Appearance | Solid |
| CAS | 20601-85-8 |
| Purity | 99.79% |
| Molecular Weight | 270.37 |
| Formula | C18H22O2 |
| Color | White to off-white |
| SMILES | OC1=CC=C(CCC)C=C1C2=CC(CCC)=CC=C2O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16338 | 3,4-O-Isopropylidene-shikimic Acid | Inquiry |
|
| PDP-16174 | Danshenxinkun B | Inquiry |
|
| PDP-15278 | Ganoderic Acid D2 | Inquiry |
|
| PDP-14779 | Pedunculoside | Inquiry |
|
| PDP-17854 | 17-Hydroxyjolkinolide A | Inquiry |
|
| PDP-18769 | 7,3'-Di-O-Methylorobol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.