Tobramycin | CAS No. | 32986-56-4 |
| Purity | 99.80% |
| Synonyms | Nebramycin Factor 6; Deoxykanamycin B |
| Molecular Weight | 467.51 |
| Formula | C18H37N5O9 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O[C@@H]([C@@H]1O[C@@]([C@@H](C[C@@H]2O)N)([H])O[C@@H]2CN)[C@H]([C@@H](C[C@@H]1N)N)O[C@@]([C@@H]([C@@H](N)[C@@H]3O)O)([H])O[C@@H]3CO |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24256 | Cedarmycin B | Inquiry |
|
| MDP-12043 | Oligomycin B | Inquiry |
|
| MDP-12281 | 5-Phenylhydantoin | Inquiry |
|
| MDP-12637 | Carbolactone | Inquiry |
|
| MDP-11681 | Ramoplanin | Inquiry |
|
| MDP-12336 | Acetylcysteine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
