Tomatine | Synonyms | α-Tomatine; Lycopersicin; Tomatin |
| Appearance | Solid |
| CAS | 17406-45-0 |
| Purity | 99.90% |
| Molecular Weight | 1034.19 |
| Formula | C50H83NO21 |
| Color | White to off-white |
| SMILES | C[C@@]12[C@]([C@@H]3C)([H])[C@](O[C@@]34CC[C@H](C)CN4)([H])C[C@@]1([H])[C@@](CC[C@]5([H])[C@@]6(CC[C@H](O[C@]([C@@H]([C@@H](O)[C@H]7O[C@@](O[C@H](CO)[C@@H](O)[C@@H]8O[C@@](OC[C@@H](O)[C@@H]9O)([H])[C@@H]9O)([H])[C@@H]8O[C@]([C@@H]([C@@H](O)[C@@H]%10O)O)([H])O[C@@H]%10CO)O)([H])O[C@@H]7CO)C5)C)([H])[C@]6([H])CC2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19639 | Sclareol (Standard) | Inquiry |
|
| PDP-19589 | Eupalinilide B | Inquiry |
|
| PDP-15616 | Enmein | Inquiry |
|
| PDP-19104 | Pasakbumin D | Inquiry |
|
| PDP-18732 | Regaloside D | Inquiry |
|
| PDP-16841 | N-Methylcorydaldine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
