N-Methylcorydaldine | CAS | 6514-05-2 |
| Molecular Weight | 221.25 |
| Formula | C12H15NO3 |
| SMILES | COC(C(OC)=C1)=CC2=C1CCN(C)C2=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19832 | Isosteviol (Standard) | Inquiry |
|
| PDP-17073 | Hispidanin B | Inquiry |
|
| PDP-14234 | Isoliquiritin Apioside | Inquiry |
|
| PDP-18110 | Pedalitin | Inquiry |
|
| PDP-17756 | AChE/BChE-IN-14 | Inquiry |
|
| PDP-17346 | 6-O-Isobutyrylbritannilactone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
