Ubiquinone-1 | CAS No. | 727-81-1 |
| Purity | ≥99.0% |
| Molecular Weight | 250.29 |
| Formula | C14H18O4 |
| Appearance | Liquid |
| Color | Orange to red |
| SMILES | O=C1C(OC)=C(OC)C(C(C)=C1C/C=C(C)\C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage | Solution, -20°C, 2 years |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22305 | Gibberellic Acid (Standard) | Inquiry |
|
| MDP-11636 | Midecamycin | Inquiry |
|
| MDP-23581 | Decarestrictin M | Inquiry |
|
| MDP-11388 | Naringinase | Inquiry |
|
| MDP-12287 | S-Pyruvylglutathione | Inquiry |
|
| MDP-23558 | Cystothiazole B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
