Urdamycin B | CAS No. | 104542-46-3 |
| Molecular Weight | 696.74 |
| Formula | C37H44O13 |
| SMILES | O=C1C2=C(C(C3=C(O)C([C@H]4C[C@H]([C@@H]([C@H](O4)C)O)O[C@@H]5O[C@H]([C@H](CC5)O[C@H]6C[C@H]([C@@H]([C@H](O6)C)O)O)C)=CC=C31)=O)C=CC(C[C@@](O)(C7)C)=C2C7=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11676 | Sterigmatocystine | Inquiry |
|
| MDP-23399 | Piperdial | Inquiry |
|
| MDP-11846 | Cyclo(Pro-Val) | Inquiry |
|
| MDP-22799 | Harzianol K | Inquiry |
|
| MDP-23796 | Napsamycin B | Inquiry |
|
| MDP-22083 | Ascochlorin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
