Sterigmatocystine | CAS No. | 10048-13-2 |
| Purity | 99.74% |
| Molecular Weight | 324.28 |
| Formula | C18H12O6 |
| Appearance | Solid |
| Color | Off-white to light yellow |
| SMILES | O=C1C2=C(OC3=C1C(O)=CC=C3)C4=C(O[C@]5([H])[C@@]4([H])C=CO5)C=C2OC |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23568 | 17-O-Demethylgeldanamycin | Inquiry |
|
| MDP-23021 | D-Tagatose (Standard) | Inquiry |
|
| MDP-22761 | 3-Hydroxyisovalerylcarnitine (Standard) | Inquiry |
|
| MDP-23604 | Epopromycin A | Inquiry |
|
| MDP-21906 | Prehelminthosporol | Inquiry |
|
| MDP-22555 | Ferrocin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
