Uric Acid | CAS No. | 69-93-2 |
| Purity | 99.96% |
| Molecular Weight | 168.11 |
| Formula | C5H4N4O3 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C(N1)NC2=C(NC(N2)=O)C1=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24337 | Porothramycin B | Inquiry |
|
| MDP-22305 | Gibberellic Acid (Standard) | Inquiry |
|
| MDP-22224 | Gyramide A | Inquiry |
|
| MDP-24238 | Cephaibol B | Inquiry |
|
| MDP-22793 | Fusaric Acid (Standard) | Inquiry |
|
| MDP-23111 | Lynamicin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
