Uvarigranol B | CAS | 164204-79-9 |
| Molecular Weight | 426.42 |
| Formula | C23H22O8 |
| SMILES | CC(O[C@@H]1[C@](O)([C@H](C=C[C@H]1OC(C2=CC=CC=C2)=O)O)COC(C3=CC=CC=C3)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20037 | Cirsilineol (Standard) | Inquiry |
|
| PDP-20282 | Polygalasaponin XXVIII | Inquiry |
|
| PDP-20399 | Pulchinenoside B | Inquiry |
|
| PDP-17468 | 11-Oxomogroside II A1 | Inquiry |
|
| PDP-17771 | Pyroside | Inquiry |
|
| PDP-17068 | Taxinine M | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
