Withanolide B (Standard) | CAS | 56973-41-2 |
| Molecular Weight | 454.60 |
| Formula | C28H38O5 |
| SMILES | C[C@@]12[C@]3([H])[C@@]([C@@]4([H])[C@](CC3)([C@@](CC4)([H])[C@@H]([C@@]5([H])CC(C)=C(C(O5)=O)C)C)C)([H])[C@H]6[C@@H]([C@]1(CC=CC2=O)O)O6 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18570 | Cowaxanthone B | Inquiry |
|
| PDP-18163 | Millewanin G | Inquiry |
|
| PDP-13843 | Kukoamine B | Inquiry |
|
| PDP-19149 | Ilexoside XLVIII | Inquiry |
|
| PDP-19468 | 2"-O-Coumaroyljuglanin | Inquiry |
|
| PDP-15599 | Kanzonol C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
