Kukoamine B | Appearance | Solid |
| CAS | 164991-67-7 |
| Purity | 99.70% |
| Molecular Weight | 530.66 |
| Formula | C28H42N4O6 |
| Color | White to off-white |
| SMILES | O=C(N(CCCN)CCCCNCCCNC(CCC1=CC=C(O)C(O)=C1)=O)CCC2=CC=C(O)C(O)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16472 | Procyanidin B2 (Standard) | Inquiry |
|
| PDP-14035 | 3'-Hydroxypterostilbene | Inquiry |
|
| PDP-18969 | 25-O-Methylcimigenol-3-O-D-xylopyranoside | Inquiry |
|
| PDP-13909 | 4-Hydroxyacetophenone | Inquiry |
|
| PDP-13116 | Celastrol | Inquiry |
|
| PDP-15700 | Guaiacin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
