2-8ºC, filled with argon.
Xylobiose 
Catalog Number OM-5806
Product Name Xylobiose
CAS No. 6860-47-5
Size 10 mg; 50 mg; 250 mg;
Aspect White powder
| CAS No. | 6860-47-5 |
| Molecular Formula | C10H18O9 |
| MW | 282.24 |
| Melting Point | 186-187ºC(lit.) |
| Boiling Point | 604.0±55.0ºC(lit.) |
| Application | Widely used in various food, animal husbandry and agricultural production. |
| Stability | Stable under recommended storage conditions. |
| Solubility | Slightly soluble. |
| Synonyms | 1,4-D-Xylobiose, 4-O-β-D-xyloglucosyl-D-xylose |
| MDL | MFCD00135984 |
| Safety Description | S24/25 |
| SMILES | O([CH]([CH]([CH](C=O)O)O)CO)[CH]1[CH](O)[CH](O)[CH](O)CO1 |
| InchiKey | SQNRKWHRVIAKLP-UHFFFAOYSA-N |
2-8ºC, filled with argon.
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5615 | D-Glucose,6-Benzoate | Inquiry |
|
| OM-5372 | Tranexamic Acid | Inquiry |
|
| OM-5332 | D-Lacoste Monohydrate | Inquiry |
|
| OM-5760 | L-Ribofuranose (9CI) | Inquiry |
|
| OM-5609 | 2,3,4,6-O-Tetraacetyl-β-D-Mannose | Inquiry |
|
| OM-5795 | Hyaluronic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
