1-O-Acetyl-6beta-O-Isobutyrylbritannilactone | CAS | 1087072-50-1 |
| Molecular Weight | 378.46 |
| Formula | C21H30O6 |
| SMILES | CC(C(O[C@H]1C([C@H](CCCOC(C)=O)C)=C(C[C@H]2OC(C([C@@H]12)=C)=O)C)=O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15782 | Apoatropine Hydrochloride | Inquiry |
|
| PDP-14429 | Flavokawain B | Inquiry |
|
| PDP-15774 | Macranthoidin A | Inquiry |
|
| PDP-17216 | 1,2,3,7-Tetrahydroxy-8-methoxy-6-methyl-9,10-anthraquinone | Inquiry |
|
| PDP-18118 | Pachyaximine A | Inquiry |
|
| PDP-13439 | Curcumol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
