2,3,4',5-Tetrahydroxystilbene 2-O-β-D-glucoside | Appearance | Solid |
| CAS | 55327-45-2 |
| Purity | 99.78% |
| Molecular Weight | 406.38 |
| Formula | C20H22O9 |
| Color | White to off-white |
| SMILES | OC(C=C1)=CC=C1/C=C/C(C=C(C=C2O)O)=C2O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19990 | Mogroside IV (Standard) | Inquiry |
|
| PDP-19261 | Anemarsaponin E1 | Inquiry |
|
| PDP-15579 | Meranzin Hydrate | Inquiry |
|
| PDP-16197 | Chamaejasmenin B | Inquiry |
|
| PDP-17405 | (-)-β-Peltatin-5-O-beta-D-glucopyranoside | Inquiry |
|
| PDP-19561 | Dihydrobonducellin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
