24R,25-Dihydroxycycloartan-3-one | CAS | 155060-48-3 |
| Molecular Weight | 458.72 |
| Formula | C30H50O3 |
| SMILES | C[C@]12[C@@]3([H])[C@@]4(CC[C@@]1([C@@](CC2)([H])[C@H](C)CC[C@@H](O)C(C)(O)C)C)[C@@]5([C@](CC3)([H])C(C)(C(CC5)=O)C)C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13247 | Cucurbitacin B | Inquiry |
|
| PDP-14409 | Jolkinolide B | Inquiry |
|
| PDP-14278 | Corynoxine B | Inquiry |
|
| PDP-18312 | Demethoxydeacetoxypseudolaric Acid B | Inquiry |
|
| PDP-18454 | Cyanidin 3-arabinoside | Inquiry |
|
| PDP-19322 | Ajugasterone C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
