3-Methoxyflavone | Appearance | Solid |
| CAS | 7245-02-5 |
| Purity | 99.88% |
| Molecular Weight | 252.26 |
| Formula | C16H12O3 |
| Color | Off-white to light yellow |
| SMILES | O=C1C(OC)=C(C2=CC=CC=C2)OC3=CC=CC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13230 | Dicoumarol | Inquiry |
|
| PDP-19835 | Melittoside (Standard) | Inquiry |
|
| PDP-15524 | 2,3-Bis(3-indolylmethyl)indole | Inquiry |
|
| PDP-19730 | Patchouli Alcohol (Standard) | Inquiry |
|
| PDP-16184 | Aleuritic Acid | Inquiry |
|
| PDP-16686 | 10-Hydroxyaloin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
