4'-Methoxyresveratrol | Synonyms | 4'-O-Methylresveratrol |
| Appearance | Solid |
| CAS | 33626-08-3 |
| Purity | 99.48% |
| Molecular Weight | 242.27 |
| Formula | C15H14O3 |
| Color | White to off-white |
| SMILES | OC1=CC(O)=CC(/C=C/C2=CC=C(OC)C=C2)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18368 | Eudesm-4(14)-ene-3α,11-diol | Inquiry |
|
| PDP-19174 | Hedysarimcoumestan B | Inquiry |
|
| PDP-14602 | Ganoderic Acid DM | Inquiry |
|
| PDP-17272 | Alismanol M | Inquiry |
|
| PDP-13418 | Scopoletin | Inquiry |
|
| PDP-13894 | Strophanthidin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
