6-Hydroxytropinone (Standard) | CAS | 5932-53-6 |
| Molecular Weight | 155.19 |
| Formula | C8H13NO2 |
| SMILES | CN1[C@@](C[C@@](O)([H])[C@@]1([H])C2)([H])CC2=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17958 | 2',4'-Dihydroxy-3,7':4,8'-diepoxylign-7-ene | Inquiry |
|
| PDP-18475 | Clematomandshurica Saponin B | Inquiry |
|
| PDP-18125 | Odorine | Inquiry |
|
| PDP-14708 | Khellin | Inquiry |
|
| PDP-14437 | Strictosamide | Inquiry |
|
| PDP-20023 | Angulasaponin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
