(+)-Afzelechin | Appearance | Solid |
| CAS | 2545-00-8 |
| Purity | ≥98.0% |
| Molecular Weight | 274.27 |
| Formula | C15H14O5 |
| Color | White to light brown |
| SMILES | O[C@@H]1[C@@H](C2=CC=C(O)C=C2)OC3=CC(O)=CC(O)=C3C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16875 | Esculentoside B | Inquiry |
|
| PDP-13947 | Methylnissolin | Inquiry |
|
| PDP-13904 | Capsaicin (Standard) | Inquiry |
|
| PDP-19476 | Farobin A | Inquiry |
|
| PDP-17487 | Epimedonin B | Inquiry |
|
| PDP-15501 | Piperlonguminine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
