Benanomicin A | CAS No. | 116249-65-1 |
| Molecular Weight | 827.74 |
| Formula | C39H41NO19 |
| SMILES | OC1=C2C3=C(O)C(C(C4=CC(OC)=CC(O)=C4C5=O)=O)=C5C=C3[C@@H]([C@H](C2=CC(C)=C1C(N[C@H](C)C(O)=O)=O)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)C)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11192 | Selenomethionine | Inquiry |
|
| MDP-22713 | Indole-3-acetamide (Standard) | Inquiry |
|
| MDP-23380 | Ivermectin (Standard) | Inquiry |
|
| MDP-23691 | Fujianmycin B | Inquiry |
|
| MDP-23004 | Sarubicin B | Inquiry |
|
| MDP-23644 | Dihydromonacolin L | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
