Bergaptol (Standard) | CAS | 486-60-2 |
| Molecular Weight | 202.16 |
| Formula | C11H6O4 |
| SMILES | O=C1C=CC(C(O1)=C2)=C(O)C3=C2OC=C3 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13738 | 1-Triacontanol | Inquiry |
|
| PDP-15054 | Complanatoside B | Inquiry |
|
| PDP-17474 | Cabenoside D | Inquiry |
|
| PDP-13466 | Lithospermic Acid | Inquiry |
|
| PDP-14530 | Inulicin | Inquiry |
|
| PDP-18136 | Neritaloside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
