Biochanin A | Synonyms | 4-Methylgenistein; Olmelin |
| Appearance | Solid |
| CAS | 491-80-5 |
| Purity | 99.29% |
| Molecular Weight | 284.26 |
| Formula | C16H12O5 |
| Color | White to yellow |
| SMILES | OC1=C2C(OC=C(C3=CC=C(OC)C=C3)C2=O)=CC(O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13237 | Carvacrol | Inquiry |
|
| PDP-16811 | Quinine Hemisulfate | Inquiry |
|
| PDP-14119 | 5,7-Dihydroxycoumarin | Inquiry |
|
| PDP-20190 | Boeravinone B (Standard) | Inquiry |
|
| PDP-18513 | Jionoside A1 | Inquiry |
|
| PDP-19574 | Daurinoline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.